C13H13FN2O3S — CID 51054868
2-(1,1-dioxothiolan-3-yl)-5-(4-fluorophenyl)-1H-pyrazol-3-one (PubChem CID 51054868) has the molecular formula C13H13FN2O3S and a molecular weight of 296.32 g/mol. Its IUPAC name is 2-(1,1-dioxothiolan-3-yl)-5-(4-fluorophenyl)-1H-pyrazol-3-one.
| Compound Name | 2-(1,1-dioxothiolan-3-yl)-5-(4-fluorophenyl)-1H-pyrazol-3-one |
|---|---|
| PubChem CID | 51054868 |
| Molecular Formula | C13H13FN2O3S |
| Molecular Weight | 296.32 g/mol |
| Exact Mass | 296.06 |
| IUPAC Name | 2-(1,1-dioxothiolan-3-yl)-5-(4-fluorophenyl)-1H-pyrazol-3-one |
| SMILES | O=c1cc(-c2ccc(F)cc2)[nH]n1C1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C13H13FN2O3S/c14-10-3-1-9(2-4-10)12-7-13(17)16(15-12)11-5-6-20(18,19)8-11/h1-4,7,11,15H,5-6,8H2 |
| InChIKey | FJBIMBCNOALQIX-UHFFFAOYSA-N |
| XLogP | 1.34 |
| TPSA | 71.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.32 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |