C15H18N2O3S — CID 52995944
4-benzyl-2-(1,1-dioxothiolan-3-yl)-5-methyl-1H-pyrazol-3-one (PubChem CID 52995944) has the molecular formula C15H18N2O3S and a molecular weight of 306.39 g/mol. Its IUPAC name is 4-benzyl-2-(1,1-dioxothiolan-3-yl)-5-methyl-1H-pyrazol-3-one.
| Compound Name | 4-benzyl-2-(1,1-dioxothiolan-3-yl)-5-methyl-1H-pyrazol-3-one |
|---|---|
| PubChem CID | 52995944 |
| Molecular Formula | C15H18N2O3S |
| Molecular Weight | 306.39 g/mol |
| Exact Mass | 306.10 |
| IUPAC Name | 4-benzyl-2-(1,1-dioxothiolan-3-yl)-5-methyl-1H-pyrazol-3-one |
| SMILES | Cc1[nH]n(C2CCS(=O)(=O)C2)c(=O)c1Cc1ccccc1 |
| InChI | InChI=1S/C15H18N2O3S/c1-11-14(9-12-5-3-2-4-6-12)15(18)17(16-11)13-7-8-21(19,20)10-13/h2-6,13,16H,7-10H2,1H3 |
| InChIKey | GULSWIZNDZSPQR-UHFFFAOYSA-N |
| XLogP | 1.44 |
| TPSA | 71.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.39 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |