About 4-benzyl-2-(1,1-dioxothiolan-3-yl)-5-methyl-1H-pyrazol-3-one
4-benzyl-2-(1,1-dioxothiolan-3-yl)-5-methyl-1H-pyrazol-3-one (PubChem CID 52995944) has the molecular formula C15H18N2O3S
and a molecular weight of 306.39 g/mol. Its IUPAC name is 4-benzyl-2-(1,1-dioxothiolan-3-yl)-5-methyl-1H-pyrazol-3-one.
Molecular Properties
| Compound Name | 4-benzyl-2-(1,1-dioxothiolan-3-yl)-5-methyl-1H-pyrazol-3-one |
| PubChem CID | 52995944 |
| Molecular Formula | C15H18N2O3S |
| Molecular Weight | 306.39 g/mol |
| Exact Mass | 306.10 |
| IUPAC Name | 4-benzyl-2-(1,1-dioxothiolan-3-yl)-5-methyl-1H-pyrazol-3-one |
| SMILES | Cc1[nH]n(C2CCS(=O)(=O)C2)c(=O)c1Cc1ccccc1 |
| InChI | InChI=1S/C15H18N2O3S/c1-11-14(9-12-5-3-2-4-6-12)15(18)17(16-11)13-7-8-21(19,20)10-13/h2-6,13,16H,7-10H2,1H3 |
| InChIKey | GULSWIZNDZSPQR-UHFFFAOYSA-N |
| XLogP | 1.44 |
| TPSA | 71.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 306.39 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 4-benzyl-2-(1,1-dioxothiolan-3-yl)-5-methyl-1H-pyrazol-3-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-benzyl-2-(1,1-dioxothiolan-3-yl)-5-methyl-1H-pyrazol-3-one?
The IUPAC name of 4-benzyl-2-(1,1-dioxothiolan-3-yl)-5-methyl-1H-pyrazol-3-one (CID 52995944) is 4-benzyl-2-(1,1-dioxothiolan-3-yl)-5-methyl-1H-pyrazol-3-one.
What is the SMILES notation for 4-benzyl-2-(1,1-dioxothiolan-3-yl)-5-methyl-1H-pyrazol-3-one?
The canonical SMILES for 4-benzyl-2-(1,1-dioxothiolan-3-yl)-5-methyl-1H-pyrazol-3-one is Cc1[nH]n(C2CCS(=O)(=O)C2)c(=O)c1Cc1ccccc1.
What is the InChIKey of 4-benzyl-2-(1,1-dioxothiolan-3-yl)-5-methyl-1H-pyrazol-3-one?
The InChIKey is GULSWIZNDZSPQR-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H18N2O3S/c1-11-14(9-12-5-3-2-4-6-12)15(18)17(16-11)13-7-8-21(19,20)10-13/h2-6,13,16H,7-10H2,1H3.
What are the key properties of 4-benzyl-2-(1,1-dioxothiolan-3-yl)-5-methyl-1H-pyrazol-3-one?
4-benzyl-2-(1,1-dioxothiolan-3-yl)-5-methyl-1H-pyrazol-3-one has a molecular weight of 306.39 g/mol, XLogP of 1.44, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-benzyl-2-(1,1-dioxothiolan-3-yl)-5-methyl-1H-pyrazol-3-one is sourced from PubChem (CID 52995944), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).