C32H31N7O10 — CID 51055779
[(2R,3R,4S,5R,6S)-4,5-dibenzoyloxy-2-[[4,5-bis(hydrazinecarbonyl)triazol-1-yl]methyl]-6-methoxyoxan-3-yl] benzoate (PubChem CID 51055779) has the molecular formula C32H31N7O10 and a molecular weight of 673.64 g/mol. Its IUPAC name is [(2R,3R,4S,5R,6S)-4,5-dibenzoyloxy-2-[[4,5-bis(hydrazinecarbonyl)triazol-1-yl]methyl]-6-methoxyoxan-3-yl] benzoate.
| Compound Name | [(2R,3R,4S,5R,6S)-4,5-dibenzoyloxy-2-[[4,5-bis(hydrazinecarbonyl)triazol-1-yl]methyl]-6-methoxyoxan-3-yl] benzoate |
|---|---|
| PubChem CID | 51055779 |
| Molecular Formula | C32H31N7O10 |
| Molecular Weight | 673.64 g/mol |
| Exact Mass | 673.21 |
| IUPAC Name | [(2R,3R,4S,5R,6S)-4,5-dibenzoyloxy-2-[[4,5-bis(hydrazinecarbonyl)triazol-1-yl]methyl]-6-methoxyoxan-3-yl] benzoate |
| SMILES | CO[C@H]1O[C@H](Cn2nnc(C(=O)NN)c2C(=O)NN)[C@@H](OC(=O)c2ccccc2)[C@H](OC(=O)c2ccccc2)[C@H]1OC(=O)c1ccccc1 |
| InChI | InChI=1S/C32H31N7O10/c1-45-32-26(49-31(44)20-15-9-4-10-16-20)25(48-30(43)19-13-7-3-8-14-19)24(47-29(42)18-11-5-2-6-12-18)21(46-32)17-39-23(28(41)36-34)22(37-38-39)27(40)35-33/h2-16,21,24-26,32H,17,33-34H2,1H3,(H,35,40)(H,36,41)/t21-,24-,25+,26-,32+/m1/s1 |
| InChIKey | CUTPCVJDXJMVKP-HRSOHXAMSA-N |
| XLogP | 0.53 |
| TPSA | 238.31 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 15 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 673.64 |
| LogP ≤ 5 | 0.53 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 15 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|