C12H15N3O2 — CID 51055853
[(Z)-[5-(furan-2-yl)-3-methylcyclohex-2-en-1-ylidene]amino]urea (PubChem CID 51055853) has the molecular formula C12H15N3O2 and a molecular weight of 233.27 g/mol. Its IUPAC name is [(Z)-[5-(furan-2-yl)-3-methylcyclohex-2-en-1-ylidene]amino]urea.
| Compound Name | [(Z)-[5-(furan-2-yl)-3-methylcyclohex-2-en-1-ylidene]amino]urea |
|---|---|
| PubChem CID | 51055853 |
| Molecular Formula | C12H15N3O2 |
| Molecular Weight | 233.27 g/mol |
| Exact Mass | 233.12 |
| IUPAC Name | [(Z)-[5-(furan-2-yl)-3-methylcyclohex-2-en-1-ylidene]amino]urea |
| SMILES | CC1=C/C(=N\NC(N)=O)CC(c2ccco2)C1 |
| InChI | InChI=1S/C12H15N3O2/c1-8-5-9(11-3-2-4-17-11)7-10(6-8)14-15-12(13)16/h2-4,6,9H,5,7H2,1H3,(H3,13,15,16)/b14-10+ |
| InChIKey | FROVHEGMFXAQLW-GXDHUFHOSA-N |
| XLogP | 2.13 |
| TPSA | 80.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.27 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|