C14H14N2O4 — CID 51056920
5-acetyl-3-(4-ethoxyphenyl)-1H-pyrimidine-2,4-dione (PubChem CID 51056920) has the molecular formula C14H14N2O4 and a molecular weight of 274.28 g/mol. Its IUPAC name is 5-acetyl-3-(4-ethoxyphenyl)-1H-pyrimidine-2,4-dione.
| Compound Name | 5-acetyl-3-(4-ethoxyphenyl)-1H-pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 51056920 |
| Molecular Formula | C14H14N2O4 |
| Molecular Weight | 274.28 g/mol |
| Exact Mass | 274.10 |
| IUPAC Name | 5-acetyl-3-(4-ethoxyphenyl)-1H-pyrimidine-2,4-dione |
| SMILES | CCOc1ccc(-n2c(=O)[nH]cc(C(C)=O)c2=O)cc1 |
| InChI | InChI=1S/C14H14N2O4/c1-3-20-11-6-4-10(5-7-11)16-13(18)12(9(2)17)8-15-14(16)19/h4-8H,3H2,1-2H3,(H,15,19) |
| InChIKey | CJWPEKOPXOAVEZ-UHFFFAOYSA-N |
| XLogP | 1.13 |
| TPSA | 81.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.28 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |