C24H22BrNO3 — CID 51058036
(E)-N-benzyl-3-[2-[(4-bromophenyl)methoxy]-3-methoxyphenyl]prop-2-enamide (PubChem CID 51058036) has the molecular formula C24H22BrNO3 and a molecular weight of 452.35 g/mol. Its IUPAC name is (E)-N-benzyl-3-[2-[(4-bromophenyl)methoxy]-3-methoxyphenyl]prop-2-enamide.
| Compound Name | (E)-N-benzyl-3-[2-[(4-bromophenyl)methoxy]-3-methoxyphenyl]prop-2-enamide |
|---|---|
| PubChem CID | 51058036 |
| Molecular Formula | C24H22BrNO3 |
| Molecular Weight | 452.35 g/mol |
| Exact Mass | 451.08 |
| IUPAC Name | (E)-N-benzyl-3-[2-[(4-bromophenyl)methoxy]-3-methoxyphenyl]prop-2-enamide |
| SMILES | COc1cccc(/C=C/C(=O)NCc2ccccc2)c1OCc1ccc(Br)cc1 |
| InChI | InChI=1S/C24H22BrNO3/c1-28-22-9-5-8-20(24(22)29-17-19-10-13-21(25)14-11-19)12-15-23(27)26-16-18-6-3-2-4-7-18/h2-15H,16-17H2,1H3,(H,26,27)/b15-12+ |
| InChIKey | XTLZTZPGPKRVLQ-NTCAYCPXSA-N |
| XLogP | 5.37 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.35 |
| LogP ≤ 5 | 5.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|