C18H19N3O5 — CID 51058692
1,3-dimethyl-5-[[5-(N-methylanilino)furan-2-yl]methylidene]-1,3-diazinane-2,4,6-trione;hydrate (PubChem CID 51058692) has the molecular formula C18H19N3O5 and a molecular weight of 357.37 g/mol. Its IUPAC name is 1,3-dimethyl-5-[[5-(N-methylanilino)furan-2-yl]methylidene]-1,3-diazinane-2,4,6-trione;hydrate.
| Compound Name | 1,3-dimethyl-5-[[5-(N-methylanilino)furan-2-yl]methylidene]-1,3-diazinane-2,4,6-trione;hydrate |
|---|---|
| PubChem CID | 51058692 |
| Molecular Formula | C18H19N3O5 |
| Molecular Weight | 357.37 g/mol |
| Exact Mass | 357.13 |
| IUPAC Name | 1,3-dimethyl-5-[[5-(N-methylanilino)furan-2-yl]methylidene]-1,3-diazinane-2,4,6-trione;hydrate |
| SMILES | CN1C(=O)C(=Cc2ccc(N(C)c3ccccc3)o2)C(=O)N(C)C1=O.O |
| InChI | InChI=1S/C18H17N3O4.H2O/c1-19(12-7-5-4-6-8-12)15-10-9-13(25-15)11-14-16(22)20(2)18(24)21(3)17(14)23;/h4-11H,1-3H3;1H2 |
| InChIKey | OSADNEFHAKVMQX-UHFFFAOYSA-N |
| XLogP | 1.66 |
| TPSA | 105.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.37 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'ene_six_het_A(483)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|