C20H20ClN4O+ — CID 51059066
1-(4-chlorophenyl)-2-(3-pyridin-4-yl-6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepin-4-ium-1-yl)ethanone (PubChem CID 51059066) has the molecular formula C20H20ClN4O+ and a molecular weight of 367.86 g/mol. Its IUPAC name is 1-(4-chlorophenyl)-2-(3-pyridin-4-yl-6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepin-4-ium-1-yl)ethanone.
| Compound Name | 1-(4-chlorophenyl)-2-(3-pyridin-4-yl-6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepin-4-ium-1-yl)ethanone |
|---|---|
| PubChem CID | 51059066 |
| Molecular Formula | C20H20ClN4O+ |
| Molecular Weight | 367.86 g/mol |
| Exact Mass | 367.13 |
| IUPAC Name | 1-(4-chlorophenyl)-2-(3-pyridin-4-yl-6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepin-4-ium-1-yl)ethanone |
| SMILES | O=C(Cn1nc(-c2ccncc2)[n+]2c1CCCCC2)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C20H20ClN4O/c21-17-7-5-15(6-8-17)18(26)14-25-19-4-2-1-3-13-24(19)20(23-25)16-9-11-22-12-10-16/h5-12H,1-4,13-14H2/q+1 |
| InChIKey | ZRWNCYLSPCFEMT-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 51.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.86 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|