C21H21F2N2O2+ — CID 11374370
2-(1,2-difluoro-7,8,9,10-tetrahydro-6H-azepino[1,2-a]benzimidazol-11-ium-5-yl)-1-(4-methoxyphenyl)ethanone (PubChem CID 11374370) has the molecular formula C21H21F2N2O2+ and a molecular weight of 371.41 g/mol. Its IUPAC name is 2-(1,2-difluoro-7,8,9,10-tetrahydro-6H-azepino[1,2-a]benzimidazol-11-ium-5-yl)-1-(4-methoxyphenyl)ethanone.
| Compound Name | 2-(1,2-difluoro-7,8,9,10-tetrahydro-6H-azepino[1,2-a]benzimidazol-11-ium-5-yl)-1-(4-methoxyphenyl)ethanone |
|---|---|
| PubChem CID | 11374370 |
| Molecular Formula | C21H21F2N2O2+ |
| Molecular Weight | 371.41 g/mol |
| Exact Mass | 371.16 |
| IUPAC Name | 2-(1,2-difluoro-7,8,9,10-tetrahydro-6H-azepino[1,2-a]benzimidazol-11-ium-5-yl)-1-(4-methoxyphenyl)ethanone |
| SMILES | COc1ccc(C(=O)Cn2c3[n+](c4c(F)c(F)ccc42)CCCCC3)cc1 |
| InChI | InChI=1S/C21H21F2N2O2/c1-27-15-8-6-14(7-9-15)18(26)13-25-17-11-10-16(22)20(23)21(17)24-12-4-2-3-5-19(24)25/h6-11H,2-5,12-13H2,1H3/q+1 |
| InChIKey | LOPPRMURQLCLSD-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 35.11 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.41 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|