C30H24Cl2N2O5 — CID 51060283
[2-methoxy-4-[(E)-[2-(4-phenylphenoxy)propanoylhydrazinylidene]methyl]phenyl] 3,4-dichlorobenzoate (PubChem CID 51060283) has the molecular formula C30H24Cl2N2O5 and a molecular weight of 563.44 g/mol. Its IUPAC name is [2-methoxy-4-[(E)-[2-(4-phenylphenoxy)propanoylhydrazinylidene]methyl]phenyl] 3,4-dichlorobenzoate.
| Compound Name | [2-methoxy-4-[(E)-[2-(4-phenylphenoxy)propanoylhydrazinylidene]methyl]phenyl] 3,4-dichlorobenzoate |
|---|---|
| PubChem CID | 51060283 |
| Molecular Formula | C30H24Cl2N2O5 |
| Molecular Weight | 563.44 g/mol |
| Exact Mass | 562.11 |
| IUPAC Name | [2-methoxy-4-[(E)-[2-(4-phenylphenoxy)propanoylhydrazinylidene]methyl]phenyl] 3,4-dichlorobenzoate |
| SMILES | COc1cc(/C=N/NC(=O)C(C)Oc2ccc(-c3ccccc3)cc2)ccc1OC(=O)c1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C30H24Cl2N2O5/c1-19(38-24-12-9-22(10-13-24)21-6-4-3-5-7-21)29(35)34-33-18-20-8-15-27(28(16-20)37-2)39-30(36)23-11-14-25(31)26(32)17-23/h3-19H,1-2H3,(H,34,35)/b33-18+ |
| InChIKey | OCCJTEKJNHLLHG-DPNNOFEESA-N |
| XLogP | 6.81 |
| TPSA | 86.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 563.44 |
| LogP ≤ 5 | 6.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|