C16H17NO2S — CID 510612
2,3,5-trimethyl-3-phenyl-1,2-benzothiazole 1,1-dioxide (PubChem CID 510612) has the molecular formula C16H17NO2S and a molecular weight of 287.38 g/mol. Its IUPAC name is 2,3,5-trimethyl-3-phenyl-1,2-benzothiazole 1,1-dioxide.
| Compound Name | 2,3,5-trimethyl-3-phenyl-1,2-benzothiazole 1,1-dioxide |
|---|---|
| PubChem CID | 510612 |
| Molecular Formula | C16H17NO2S |
| Molecular Weight | 287.38 g/mol |
| Exact Mass | 287.10 |
| IUPAC Name | 2,3,5-trimethyl-3-phenyl-1,2-benzothiazole 1,1-dioxide |
| SMILES | Cc1ccc2c(c1)C(C)(c1ccccc1)N(C)S2(=O)=O |
| InChI | InChI=1S/C16H17NO2S/c1-12-9-10-15-14(11-12)16(2,17(3)20(15,18)19)13-7-5-4-6-8-13/h4-11H,1-3H3 |
| InChIKey | YLHGMRSUHZSNCB-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.38 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |