About methyl 4-(3-cyano-4-oxopyrrolidin-1-yl)benzoate;hydrate
methyl 4-(3-cyano-4-oxopyrrolidin-1-yl)benzoate;hydrate (PubChem CID 51062060) has the molecular formula C13H14N2O4
and a molecular weight of 262.26 g/mol. Its IUPAC name is methyl 4-(3-cyano-4-oxopyrrolidin-1-yl)benzoate;hydrate.
Molecular Properties
| Compound Name | methyl 4-(3-cyano-4-oxopyrrolidin-1-yl)benzoate;hydrate |
| PubChem CID | 51062060 |
| Molecular Formula | C13H14N2O4 |
| Molecular Weight | 262.26 g/mol |
| Exact Mass | 262.10 |
| IUPAC Name | methyl 4-(3-cyano-4-oxopyrrolidin-1-yl)benzoate;hydrate |
| SMILES | COC(=O)c1ccc(N2CC(=O)C(C#N)C2)cc1.O |
| InChI | InChI=1S/C13H12N2O3.H2O/c1-18-13(17)9-2-4-11(5-3-9)15-7-10(6-14)12(16)8-15;/h2-5,10H,7-8H2,1H3;1H2 |
| InChIKey | RGUDDTAODQGCRQ-UHFFFAOYSA-N |
| XLogP | 0.18 |
| TPSA | 101.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 262.26 |
| LogP ≤ 5 | 0.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'cyano_keto_A(2)', 'substructure': 'N/A'} |
|---|
Analyze methyl 4-(3-cyano-4-oxopyrrolidin-1-yl)benzoate;hydrate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 4-(3-cyano-4-oxopyrrolidin-1-yl)benzoate;hydrate?
The IUPAC name of methyl 4-(3-cyano-4-oxopyrrolidin-1-yl)benzoate;hydrate (CID 51062060) is methyl 4-(3-cyano-4-oxopyrrolidin-1-yl)benzoate;hydrate.
What is the SMILES notation for methyl 4-(3-cyano-4-oxopyrrolidin-1-yl)benzoate;hydrate?
The canonical SMILES for methyl 4-(3-cyano-4-oxopyrrolidin-1-yl)benzoate;hydrate is COC(=O)c1ccc(N2CC(=O)C(C#N)C2)cc1.O.
What is the InChIKey of methyl 4-(3-cyano-4-oxopyrrolidin-1-yl)benzoate;hydrate?
The InChIKey is RGUDDTAODQGCRQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H12N2O3.H2O/c1-18-13(17)9-2-4-11(5-3-9)15-7-10(6-14)12(16)8-15;/h2-5,10H,7-8H2,1H3;1H2.
What are the key properties of methyl 4-(3-cyano-4-oxopyrrolidin-1-yl)benzoate;hydrate?
methyl 4-(3-cyano-4-oxopyrrolidin-1-yl)benzoate;hydrate has a molecular weight of 262.26 g/mol, XLogP of 0.18, 2 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 4-(3-cyano-4-oxopyrrolidin-1-yl)benzoate;hydrate is sourced from PubChem (CID 51062060), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).