C13H12N2O4 — CID 117010510
methyl 4-(6-cyano-2-oxo-1,3-oxazinan-3-yl)benzoate (PubChem CID 117010510) has the molecular formula C13H12N2O4 and a molecular weight of 260.25 g/mol. Its IUPAC name is methyl 4-(6-cyano-2-oxo-1,3-oxazinan-3-yl)benzoate.
| Compound Name | methyl 4-(6-cyano-2-oxo-1,3-oxazinan-3-yl)benzoate |
|---|---|
| PubChem CID | 117010510 |
| Molecular Formula | C13H12N2O4 |
| Molecular Weight | 260.25 g/mol |
| Exact Mass | 260.08 |
| IUPAC Name | methyl 4-(6-cyano-2-oxo-1,3-oxazinan-3-yl)benzoate |
| SMILES | COC(=O)c1ccc(N2CCC(C#N)OC2=O)cc1 |
| InChI | InChI=1S/C13H12N2O4/c1-18-12(16)9-2-4-10(5-3-9)15-7-6-11(8-14)19-13(15)17/h2-5,11H,6-7H2,1H3 |
| InChIKey | CJYZZNIPCBQSPM-UHFFFAOYSA-N |
| XLogP | 1.71 |
| TPSA | 79.63 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.25 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |