C16H22N2O3 — CID 97350843
methyl 4-[[(2S,3R)-1,2-dimethylpiperidin-3-yl]carbamoyl]benzoate (PubChem CID 97350843) has the molecular formula C16H22N2O3 and a molecular weight of 290.36 g/mol. Its IUPAC name is methyl 4-[[(2S,3R)-1,2-dimethylpiperidin-3-yl]carbamoyl]benzoate.
| Compound Name | methyl 4-[[(2S,3R)-1,2-dimethylpiperidin-3-yl]carbamoyl]benzoate |
|---|---|
| PubChem CID | 97350843 |
| Molecular Formula | C16H22N2O3 |
| Molecular Weight | 290.36 g/mol |
| Exact Mass | 290.16 |
| IUPAC Name | methyl 4-[[(2S,3R)-1,2-dimethylpiperidin-3-yl]carbamoyl]benzoate |
| SMILES | COC(=O)c1ccc(C(=O)N[C@@H]2CCCN(C)[C@H]2C)cc1 |
| InChI | InChI=1S/C16H22N2O3/c1-11-14(5-4-10-18(11)2)17-15(19)12-6-8-13(9-7-12)16(20)21-3/h6-9,11,14H,4-5,10H2,1-3H3,(H,17,19)/t11-,14+/m0/s1 |
| InChIKey | BOQPVRDYAIEFLT-SMDDNHRTSA-N |
| XLogP | 1.69 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.36 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |