C23H25BrN3O5+ — CID 5106235
2-[3-[(4-bromophenyl)-hydroxymethylidene]-2-(4-nitrophenyl)-4,5-dioxopyrrolidin-1-yl]ethyl-diethylazanium (PubChem CID 5106235) has the molecular formula C23H25BrN3O5+ and a molecular weight of 503.37 g/mol. Its IUPAC name is 2-[3-[(4-bromophenyl)-hydroxymethylidene]-2-(4-nitrophenyl)-4,5-dioxopyrrolidin-1-yl]ethyl-diethylazanium.
| Compound Name | 2-[3-[(4-bromophenyl)-hydroxymethylidene]-2-(4-nitrophenyl)-4,5-dioxopyrrolidin-1-yl]ethyl-diethylazanium |
|---|---|
| PubChem CID | 5106235 |
| Molecular Formula | C23H25BrN3O5+ |
| Molecular Weight | 503.37 g/mol |
| Exact Mass | 502.10 |
| IUPAC Name | 2-[3-[(4-bromophenyl)-hydroxymethylidene]-2-(4-nitrophenyl)-4,5-dioxopyrrolidin-1-yl]ethyl-diethylazanium |
| SMILES | CC[NH+](CC)CCN1C(=O)C(=O)C(=C(O)c2ccc(Br)cc2)C1c1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C23H24BrN3O5/c1-3-25(4-2)13-14-26-20(15-7-11-18(12-8-15)27(31)32)19(22(29)23(26)30)21(28)16-5-9-17(24)10-6-16/h5-12,20,28H,3-4,13-14H2,1-2H3/p+1 |
| InChIKey | RGSUNCKUPVZXDK-UHFFFAOYSA-O |
| XLogP | 2.70 |
| TPSA | 105.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.37 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|