C20H17NO5 — CID 510697
4-[2-(3-cyanopropoxy)-5-phenylphenyl]-2,4-dioxobutanoic acid (PubChem CID 510697) has the molecular formula C20H17NO5 and a molecular weight of 351.36 g/mol. Its IUPAC name is 4-[2-(3-cyanopropoxy)-5-phenylphenyl]-2,4-dioxobutanoic acid.
| Compound Name | 4-[2-(3-cyanopropoxy)-5-phenylphenyl]-2,4-dioxobutanoic acid |
|---|---|
| PubChem CID | 510697 |
| Molecular Formula | C20H17NO5 |
| Molecular Weight | 351.36 g/mol |
| Exact Mass | 351.11 |
| IUPAC Name | 4-[2-(3-cyanopropoxy)-5-phenylphenyl]-2,4-dioxobutanoic acid |
| SMILES | N#CCCCOc1ccc(-c2ccccc2)cc1C(=O)CC(=O)C(=O)O |
| InChI | InChI=1S/C20H17NO5/c21-10-4-5-11-26-19-9-8-15(14-6-2-1-3-7-14)12-16(19)17(22)13-18(23)20(24)25/h1-3,6-9,12H,4-5,11,13H2,(H,24,25) |
| InChIKey | JSJHYNWLPFVICZ-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 104.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.36 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|