C19H19N3O3S2 — CID 5107165
methyl 2-[(4-oxopyrido[3,2-e][1,3]thiazin-2-yl)amino]-4,5,6,7,8,9-hexahydrocycloocta[b]thiophene-3-carboxylate (PubChem CID 5107165) has the molecular formula C19H19N3O3S2 and a molecular weight of 401.51 g/mol. Its IUPAC name is methyl 2-[(4-oxopyrido[3,2-e][1,3]thiazin-2-yl)amino]-4,5,6,7,8,9-hexahydrocycloocta[b]thiophene-3-carboxylate.
| Compound Name | methyl 2-[(4-oxopyrido[3,2-e][1,3]thiazin-2-yl)amino]-4,5,6,7,8,9-hexahydrocycloocta[b]thiophene-3-carboxylate |
|---|---|
| PubChem CID | 5107165 |
| Molecular Formula | C19H19N3O3S2 |
| Molecular Weight | 401.51 g/mol |
| Exact Mass | 401.09 |
| IUPAC Name | methyl 2-[(4-oxopyrido[3,2-e][1,3]thiazin-2-yl)amino]-4,5,6,7,8,9-hexahydrocycloocta[b]thiophene-3-carboxylate |
| SMILES | COC(=O)c1c(Nc2nc(=O)c3cccnc3s2)sc2c1CCCCCC2 |
| InChI | InChI=1S/C19H19N3O3S2/c1-25-18(24)14-11-7-4-2-3-5-9-13(11)26-17(14)22-19-21-15(23)12-8-6-10-20-16(12)27-19/h6,8,10H,2-5,7,9H2,1H3,(H,21,22,23) |
| InChIKey | VKVQKSPJUOFALD-UHFFFAOYSA-N |
| XLogP | 4.30 |
| TPSA | 81.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.51 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |