C16H17N3O2S2 — CID 4508945
methyl 2-(pyridin-3-ylmethylcarbamothioylamino)-5,6-dihydro-4H-cyclopenta[b]thiophene-3-carboxylate (PubChem CID 4508945) has the molecular formula C16H17N3O2S2 and a molecular weight of 347.47 g/mol. Its IUPAC name is methyl 2-(pyridin-3-ylmethylcarbamothioylamino)-5,6-dihydro-4H-cyclopenta[b]thiophene-3-carboxylate.
| Compound Name | methyl 2-(pyridin-3-ylmethylcarbamothioylamino)-5,6-dihydro-4H-cyclopenta[b]thiophene-3-carboxylate |
|---|---|
| PubChem CID | 4508945 |
| Molecular Formula | C16H17N3O2S2 |
| Molecular Weight | 347.47 g/mol |
| Exact Mass | 347.08 |
| IUPAC Name | methyl 2-(pyridin-3-ylmethylcarbamothioylamino)-5,6-dihydro-4H-cyclopenta[b]thiophene-3-carboxylate |
| SMILES | COC(=O)c1c(NC(=S)NCc2cccnc2)sc2c1CCC2 |
| InChI | InChI=1S/C16H17N3O2S2/c1-21-15(20)13-11-5-2-6-12(11)23-14(13)19-16(22)18-9-10-4-3-7-17-8-10/h3-4,7-8H,2,5-6,9H2,1H3,(H2,18,19,22) |
| InChIKey | MLLLZPHSKJQZRS-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 63.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.47 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|