C17H29N3O3 — CID 51073460
3-(2,5-dioxoimidazolidin-4-yl)-N-[4-(2-methylbutan-2-yl)cyclohexyl]propanamide (PubChem CID 51073460) has the molecular formula C17H29N3O3 and a molecular weight of 323.44 g/mol. Its IUPAC name is 3-(2,5-dioxoimidazolidin-4-yl)-N-[4-(2-methylbutan-2-yl)cyclohexyl]propanamide.
| Compound Name | 3-(2,5-dioxoimidazolidin-4-yl)-N-[4-(2-methylbutan-2-yl)cyclohexyl]propanamide |
|---|---|
| PubChem CID | 51073460 |
| Molecular Formula | C17H29N3O3 |
| Molecular Weight | 323.44 g/mol |
| Exact Mass | 323.22 |
| IUPAC Name | 3-(2,5-dioxoimidazolidin-4-yl)-N-[4-(2-methylbutan-2-yl)cyclohexyl]propanamide |
| SMILES | CCC(C)(C)C1CCC(NC(=O)CCC2NC(=O)NC2=O)CC1 |
| InChI | InChI=1S/C17H29N3O3/c1-4-17(2,3)11-5-7-12(8-6-11)18-14(21)10-9-13-15(22)20-16(23)19-13/h11-13H,4-10H2,1-3H3,(H,18,21)(H2,19,20,22,23) |
| InChIKey | RKXAWKRQWHHYJS-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 87.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.44 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|