C24H35N3O3 — CID 47009749
2-[2,5-dioxo-4-(2-phenylethyl)imidazolidin-1-yl]-N-[4-(2-methylbutan-2-yl)cyclohexyl]acetamide (PubChem CID 47009749) has the molecular formula C24H35N3O3 and a molecular weight of 413.56 g/mol. Its IUPAC name is 2-[2,5-dioxo-4-(2-phenylethyl)imidazolidin-1-yl]-N-[4-(2-methylbutan-2-yl)cyclohexyl]acetamide.
| Compound Name | 2-[2,5-dioxo-4-(2-phenylethyl)imidazolidin-1-yl]-N-[4-(2-methylbutan-2-yl)cyclohexyl]acetamide |
|---|---|
| PubChem CID | 47009749 |
| Molecular Formula | C24H35N3O3 |
| Molecular Weight | 413.56 g/mol |
| Exact Mass | 413.27 |
| IUPAC Name | 2-[2,5-dioxo-4-(2-phenylethyl)imidazolidin-1-yl]-N-[4-(2-methylbutan-2-yl)cyclohexyl]acetamide |
| SMILES | CCC(C)(C)C1CCC(NC(=O)CN2C(=O)NC(CCc3ccccc3)C2=O)CC1 |
| InChI | InChI=1S/C24H35N3O3/c1-4-24(2,3)18-11-13-19(14-12-18)25-21(28)16-27-22(29)20(26-23(27)30)15-10-17-8-6-5-7-9-17/h5-9,18-20H,4,10-16H2,1-3H3,(H,25,28)(H,26,30) |
| InChIKey | CAGBHXXHKVWTCP-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.56 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|