C20H17NO3 — CID 51074599
2-(8-methyl-3,4-dihydro-2H-quinoline-1-carbonyl)chromen-4-one (PubChem CID 51074599) has the molecular formula C20H17NO3 and a molecular weight of 319.36 g/mol. Its IUPAC name is 2-(8-methyl-3,4-dihydro-2H-quinoline-1-carbonyl)chromen-4-one.
| Compound Name | 2-(8-methyl-3,4-dihydro-2H-quinoline-1-carbonyl)chromen-4-one |
|---|---|
| PubChem CID | 51074599 |
| Molecular Formula | C20H17NO3 |
| Molecular Weight | 319.36 g/mol |
| Exact Mass | 319.12 |
| IUPAC Name | 2-(8-methyl-3,4-dihydro-2H-quinoline-1-carbonyl)chromen-4-one |
| SMILES | Cc1cccc2c1N(C(=O)c1cc(=O)c3ccccc3o1)CCC2 |
| InChI | InChI=1S/C20H17NO3/c1-13-6-4-7-14-8-5-11-21(19(13)14)20(23)18-12-16(22)15-9-2-3-10-17(15)24-18/h2-4,6-7,9-10,12H,5,8,11H2,1H3 |
| InChIKey | RIWLBWROSWKGJG-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 50.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.36 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |