C16H19N3O4 — CID 51077827
methyl 2-[(3-ethyl-4-oxophthalazine-1-carbonyl)amino]-2-methylpropanoate (PubChem CID 51077827) has the molecular formula C16H19N3O4 and a molecular weight of 317.35 g/mol. Its IUPAC name is methyl 2-[(3-ethyl-4-oxophthalazine-1-carbonyl)amino]-2-methylpropanoate.
| Compound Name | methyl 2-[(3-ethyl-4-oxophthalazine-1-carbonyl)amino]-2-methylpropanoate |
|---|---|
| PubChem CID | 51077827 |
| Molecular Formula | C16H19N3O4 |
| Molecular Weight | 317.35 g/mol |
| Exact Mass | 317.14 |
| IUPAC Name | methyl 2-[(3-ethyl-4-oxophthalazine-1-carbonyl)amino]-2-methylpropanoate |
| SMILES | CCn1nc(C(=O)NC(C)(C)C(=O)OC)c2ccccc2c1=O |
| InChI | InChI=1S/C16H19N3O4/c1-5-19-14(21)11-9-7-6-8-10(11)12(18-19)13(20)17-16(2,3)15(22)23-4/h6-9H,5H2,1-4H3,(H,17,20) |
| InChIKey | ZOQLOXVDEGQFKA-UHFFFAOYSA-N |
| XLogP | 1.10 |
| TPSA | 90.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.35 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |