C12H17NO2 — CID 51077874
(Z)-N-(furan-2-ylmethyl)-N,2-dimethylpent-2-enamide (PubChem CID 51077874) has the molecular formula C12H17NO2 and a molecular weight of 207.27 g/mol. Its IUPAC name is (Z)-N-(furan-2-ylmethyl)-N,2-dimethylpent-2-enamide.
| Compound Name | (Z)-N-(furan-2-ylmethyl)-N,2-dimethylpent-2-enamide |
|---|---|
| PubChem CID | 51077874 |
| Molecular Formula | C12H17NO2 |
| Molecular Weight | 207.27 g/mol |
| Exact Mass | 207.13 |
| IUPAC Name | (Z)-N-(furan-2-ylmethyl)-N,2-dimethylpent-2-enamide |
| SMILES | CC/C=C(/C)C(=O)N(C)Cc1ccco1 |
| InChI | InChI=1S/C12H17NO2/c1-4-6-10(2)12(14)13(3)9-11-7-5-8-15-11/h5-8H,4,9H2,1-3H3/b10-6- |
| InChIKey | UNSJIHGXKYZMAL-POHAHGRESA-N |
| XLogP | 2.59 |
| TPSA | 33.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 207.27 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|