C16H20N4O2 — CID 51078485
1-(2,3-dihydro-1-benzofuran-2-ylmethyl)-3-(3-pyrazol-1-ylpropyl)urea (PubChem CID 51078485) has the molecular formula C16H20N4O2 and a molecular weight of 300.36 g/mol. Its IUPAC name is 1-(2,3-dihydro-1-benzofuran-2-ylmethyl)-3-(3-pyrazol-1-ylpropyl)urea.
| Compound Name | 1-(2,3-dihydro-1-benzofuran-2-ylmethyl)-3-(3-pyrazol-1-ylpropyl)urea |
|---|---|
| PubChem CID | 51078485 |
| Molecular Formula | C16H20N4O2 |
| Molecular Weight | 300.36 g/mol |
| Exact Mass | 300.16 |
| IUPAC Name | 1-(2,3-dihydro-1-benzofuran-2-ylmethyl)-3-(3-pyrazol-1-ylpropyl)urea |
| SMILES | O=C(NCCCn1cccn1)NCC1Cc2ccccc2O1 |
| InChI | InChI=1S/C16H20N4O2/c21-16(17-7-3-9-20-10-4-8-19-20)18-12-14-11-13-5-1-2-6-15(13)22-14/h1-2,4-6,8,10,14H,3,7,9,11-12H2,(H2,17,18,21) |
| InChIKey | LRESDDBXSJONLA-UHFFFAOYSA-N |
| XLogP | 1.58 |
| TPSA | 68.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.36 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|