C9H14F3NOS — CID 51078914
N-(1-cyclopropylethyl)-N-methyl-2-(trifluoromethylsulfanyl)acetamide (PubChem CID 51078914) has the molecular formula C9H14F3NOS and a molecular weight of 241.28 g/mol. Its IUPAC name is N-(1-cyclopropylethyl)-N-methyl-2-(trifluoromethylsulfanyl)acetamide.
| Compound Name | N-(1-cyclopropylethyl)-N-methyl-2-(trifluoromethylsulfanyl)acetamide |
|---|---|
| PubChem CID | 51078914 |
| Molecular Formula | C9H14F3NOS |
| Molecular Weight | 241.28 g/mol |
| Exact Mass | 241.07 |
| IUPAC Name | N-(1-cyclopropylethyl)-N-methyl-2-(trifluoromethylsulfanyl)acetamide |
| SMILES | CC(C1CC1)N(C)C(=O)CSC(F)(F)F |
| InChI | InChI=1S/C9H14F3NOS/c1-6(7-3-4-7)13(2)8(14)5-15-9(10,11)12/h6-7H,3-5H2,1-2H3 |
| InChIKey | VVIWXMAHNPFCNU-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.28 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |