C17H22N4OS — CID 51078992
3-methyl-5-(methylamino)-N-[(4-pyrrolidin-1-ylphenyl)methyl]-1,2-thiazole-4-carboxamide (PubChem CID 51078992) has the molecular formula C17H22N4OS and a molecular weight of 330.46 g/mol. Its IUPAC name is 3-methyl-5-(methylamino)-N-[(4-pyrrolidin-1-ylphenyl)methyl]-1,2-thiazole-4-carboxamide.
| Compound Name | 3-methyl-5-(methylamino)-N-[(4-pyrrolidin-1-ylphenyl)methyl]-1,2-thiazole-4-carboxamide |
|---|---|
| PubChem CID | 51078992 |
| Molecular Formula | C17H22N4OS |
| Molecular Weight | 330.46 g/mol |
| Exact Mass | 330.15 |
| IUPAC Name | 3-methyl-5-(methylamino)-N-[(4-pyrrolidin-1-ylphenyl)methyl]-1,2-thiazole-4-carboxamide |
| SMILES | CNc1snc(C)c1C(=O)NCc1ccc(N2CCCC2)cc1 |
| InChI | InChI=1S/C17H22N4OS/c1-12-15(17(18-2)23-20-12)16(22)19-11-13-5-7-14(8-6-13)21-9-3-4-10-21/h5-8,18H,3-4,9-11H2,1-2H3,(H,19,22) |
| InChIKey | UCYBKUSHWPXCCZ-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 57.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.46 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|