C16H19N3OS — CID 154837608
3-methyl-N-[(4-pyrrolidin-1-ylphenyl)methyl]-1,2-thiazole-4-carboxamide (PubChem CID 154837608) has the molecular formula C16H19N3OS and a molecular weight of 301.42 g/mol. Its IUPAC name is 3-methyl-N-[(4-pyrrolidin-1-ylphenyl)methyl]-1,2-thiazole-4-carboxamide.
| Compound Name | 3-methyl-N-[(4-pyrrolidin-1-ylphenyl)methyl]-1,2-thiazole-4-carboxamide |
|---|---|
| PubChem CID | 154837608 |
| Molecular Formula | C16H19N3OS |
| Molecular Weight | 301.42 g/mol |
| Exact Mass | 301.12 |
| IUPAC Name | 3-methyl-N-[(4-pyrrolidin-1-ylphenyl)methyl]-1,2-thiazole-4-carboxamide |
| SMILES | Cc1nscc1C(=O)NCc1ccc(N2CCCC2)cc1 |
| InChI | InChI=1S/C16H19N3OS/c1-12-15(11-21-18-12)16(20)17-10-13-4-6-14(7-5-13)19-8-2-3-9-19/h4-7,11H,2-3,8-10H2,1H3,(H,17,20) |
| InChIKey | RXNUNDWWEBHLGZ-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 45.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.42 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|