C20H25N3O2 — CID 53195349
2-cyclobutyl-5-methyl-N-[(4-pyrrolidin-1-ylphenyl)methyl]-1,3-oxazole-4-carboxamide (PubChem CID 53195349) has the molecular formula C20H25N3O2 and a molecular weight of 339.44 g/mol. Its IUPAC name is 2-cyclobutyl-5-methyl-N-[(4-pyrrolidin-1-ylphenyl)methyl]-1,3-oxazole-4-carboxamide.
| Compound Name | 2-cyclobutyl-5-methyl-N-[(4-pyrrolidin-1-ylphenyl)methyl]-1,3-oxazole-4-carboxamide |
|---|---|
| PubChem CID | 53195349 |
| Molecular Formula | C20H25N3O2 |
| Molecular Weight | 339.44 g/mol |
| Exact Mass | 339.19 |
| IUPAC Name | 2-cyclobutyl-5-methyl-N-[(4-pyrrolidin-1-ylphenyl)methyl]-1,3-oxazole-4-carboxamide |
| SMILES | Cc1oc(C2CCC2)nc1C(=O)NCc1ccc(N2CCCC2)cc1 |
| InChI | InChI=1S/C20H25N3O2/c1-14-18(22-20(25-14)16-5-4-6-16)19(24)21-13-15-7-9-17(10-8-15)23-11-2-3-12-23/h7-10,16H,2-6,11-13H2,1H3,(H,21,24) |
| InChIKey | QFKYJPRYOATUTA-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 58.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.44 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|