C14H15N3O3S — CID 51083763
ethyl 2,4-dimethyl-5-[(E)-3-(thiadiazol-4-yl)prop-2-enoyl]-1H-pyrrole-3-carboxylate (PubChem CID 51083763) has the molecular formula C14H15N3O3S and a molecular weight of 305.36 g/mol. Its IUPAC name is ethyl 2,4-dimethyl-5-[(E)-3-(thiadiazol-4-yl)prop-2-enoyl]-1H-pyrrole-3-carboxylate.
| Compound Name | ethyl 2,4-dimethyl-5-[(E)-3-(thiadiazol-4-yl)prop-2-enoyl]-1H-pyrrole-3-carboxylate |
|---|---|
| PubChem CID | 51083763 |
| Molecular Formula | C14H15N3O3S |
| Molecular Weight | 305.36 g/mol |
| Exact Mass | 305.08 |
| IUPAC Name | ethyl 2,4-dimethyl-5-[(E)-3-(thiadiazol-4-yl)prop-2-enoyl]-1H-pyrrole-3-carboxylate |
| SMILES | CCOC(=O)c1c(C)[nH]c(C(=O)/C=C/c2csnn2)c1C |
| InChI | InChI=1S/C14H15N3O3S/c1-4-20-14(19)12-8(2)13(15-9(12)3)11(18)6-5-10-7-21-17-16-10/h5-7,15H,4H2,1-3H3/b6-5+ |
| InChIKey | MOKHYCYMNBVQGZ-AATRIKPKSA-N |
| XLogP | 2.56 |
| TPSA | 84.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.36 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|