C19H26N4O2 — CID 51084468
3-[3-(2,3-dihydroindol-1-yl)propyl]-1-[(3,5-dimethyl-1,2-oxazol-4-yl)methyl]-1-methylurea (PubChem CID 51084468) has the molecular formula C19H26N4O2 and a molecular weight of 342.44 g/mol. Its IUPAC name is 3-[3-(2,3-dihydroindol-1-yl)propyl]-1-[(3,5-dimethyl-1,2-oxazol-4-yl)methyl]-1-methylurea.
| Compound Name | 3-[3-(2,3-dihydroindol-1-yl)propyl]-1-[(3,5-dimethyl-1,2-oxazol-4-yl)methyl]-1-methylurea |
|---|---|
| PubChem CID | 51084468 |
| Molecular Formula | C19H26N4O2 |
| Molecular Weight | 342.44 g/mol |
| Exact Mass | 342.21 |
| IUPAC Name | 3-[3-(2,3-dihydroindol-1-yl)propyl]-1-[(3,5-dimethyl-1,2-oxazol-4-yl)methyl]-1-methylurea |
| SMILES | Cc1noc(C)c1CN(C)C(=O)NCCCN1CCc2ccccc21 |
| InChI | InChI=1S/C19H26N4O2/c1-14-17(15(2)25-21-14)13-22(3)19(24)20-10-6-11-23-12-9-16-7-4-5-8-18(16)23/h4-5,7-8H,6,9-13H2,1-3H3,(H,20,24) |
| InChIKey | UIJMWPICBVCYEE-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 61.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.44 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|