C13H20N4O3S — CID 51084629
N-[(6-methyl-3-pyridinyl)methyl]-4-methylsulfonylpiperazine-1-carboxamide (PubChem CID 51084629) has the molecular formula C13H20N4O3S and a molecular weight of 312.39 g/mol. Its IUPAC name is N-[(6-methyl-3-pyridinyl)methyl]-4-methylsulfonylpiperazine-1-carboxamide.
| Compound Name | N-[(6-methyl-3-pyridinyl)methyl]-4-methylsulfonylpiperazine-1-carboxamide |
|---|---|
| PubChem CID | 51084629 |
| Molecular Formula | C13H20N4O3S |
| Molecular Weight | 312.39 g/mol |
| Exact Mass | 312.13 |
| IUPAC Name | N-[(6-methyl-3-pyridinyl)methyl]-4-methylsulfonylpiperazine-1-carboxamide |
| SMILES | Cc1ccc(CNC(=O)N2CCN(S(C)(=O)=O)CC2)cn1 |
| InChI | InChI=1S/C13H20N4O3S/c1-11-3-4-12(9-14-11)10-15-13(18)16-5-7-17(8-6-16)21(2,19)20/h3-4,9H,5-8,10H2,1-2H3,(H,15,18) |
| InChIKey | AQVPPPGOIUYNIU-UHFFFAOYSA-N |
| XLogP | 0.18 |
| TPSA | 82.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.39 |
| LogP ≤ 5 | 0.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |