C20H26N4O5S — CID 41191852
4-(4-ethoxyphenyl)sulfonyl-N-[(6-methoxy-3-pyridinyl)methyl]piperazine-1-carboxamide (PubChem CID 41191852) has the molecular formula C20H26N4O5S and a molecular weight of 434.52 g/mol. Its IUPAC name is 4-(4-ethoxyphenyl)sulfonyl-N-[(6-methoxy-3-pyridinyl)methyl]piperazine-1-carboxamide.
| Compound Name | 4-(4-ethoxyphenyl)sulfonyl-N-[(6-methoxy-3-pyridinyl)methyl]piperazine-1-carboxamide |
|---|---|
| PubChem CID | 41191852 |
| Molecular Formula | C20H26N4O5S |
| Molecular Weight | 434.52 g/mol |
| Exact Mass | 434.16 |
| IUPAC Name | 4-(4-ethoxyphenyl)sulfonyl-N-[(6-methoxy-3-pyridinyl)methyl]piperazine-1-carboxamide |
| SMILES | CCOc1ccc(S(=O)(=O)N2CCN(C(=O)NCc3ccc(OC)nc3)CC2)cc1 |
| InChI | InChI=1S/C20H26N4O5S/c1-3-29-17-5-7-18(8-6-17)30(26,27)24-12-10-23(11-13-24)20(25)22-15-16-4-9-19(28-2)21-14-16/h4-9,14H,3,10-13,15H2,1-2H3,(H,22,25) |
| InChIKey | SSPCNRZJUPGYIA-UHFFFAOYSA-N |
| XLogP | 1.71 |
| TPSA | 101.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.52 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |