C18H23N3O5S — CID 55809205
4-(4-ethoxyphenyl)sulfonyl-N-(furan-3-ylmethyl)piperazine-1-carboxamide (PubChem CID 55809205) has the molecular formula C18H23N3O5S and a molecular weight of 393.47 g/mol. Its IUPAC name is 4-(4-ethoxyphenyl)sulfonyl-N-(furan-3-ylmethyl)piperazine-1-carboxamide.
| Compound Name | 4-(4-ethoxyphenyl)sulfonyl-N-(furan-3-ylmethyl)piperazine-1-carboxamide |
|---|---|
| PubChem CID | 55809205 |
| Molecular Formula | C18H23N3O5S |
| Molecular Weight | 393.47 g/mol |
| Exact Mass | 393.14 |
| IUPAC Name | 4-(4-ethoxyphenyl)sulfonyl-N-(furan-3-ylmethyl)piperazine-1-carboxamide |
| SMILES | CCOc1ccc(S(=O)(=O)N2CCN(C(=O)NCc3ccoc3)CC2)cc1 |
| InChI | InChI=1S/C18H23N3O5S/c1-2-26-16-3-5-17(6-4-16)27(23,24)21-10-8-20(9-11-21)18(22)19-13-15-7-12-25-14-15/h3-7,12,14H,2,8-11,13H2,1H3,(H,19,22) |
| InChIKey | GHFRXLSWSPAZSU-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 92.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.47 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |