C18H25N5O2 — CID 51084970
4-[(4-ethoxyphenyl)methyl]-N-(1H-pyrazol-5-ylmethyl)piperazine-1-carboxamide (PubChem CID 51084970) has the molecular formula C18H25N5O2 and a molecular weight of 343.43 g/mol. Its IUPAC name is 4-[(4-ethoxyphenyl)methyl]-N-(1H-pyrazol-5-ylmethyl)piperazine-1-carboxamide.
| Compound Name | 4-[(4-ethoxyphenyl)methyl]-N-(1H-pyrazol-5-ylmethyl)piperazine-1-carboxamide |
|---|---|
| PubChem CID | 51084970 |
| Molecular Formula | C18H25N5O2 |
| Molecular Weight | 343.43 g/mol |
| Exact Mass | 343.20 |
| IUPAC Name | 4-[(4-ethoxyphenyl)methyl]-N-(1H-pyrazol-5-ylmethyl)piperazine-1-carboxamide |
| SMILES | CCOc1ccc(CN2CCN(C(=O)NCc3ccn[nH]3)CC2)cc1 |
| InChI | InChI=1S/C18H25N5O2/c1-2-25-17-5-3-15(4-6-17)14-22-9-11-23(12-10-22)18(24)19-13-16-7-8-20-21-16/h3-8H,2,9-14H2,1H3,(H,19,24)(H,20,21) |
| InChIKey | NPVKPCFLYMVUFN-UHFFFAOYSA-N |
| XLogP | 1.84 |
| TPSA | 73.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.43 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |