C25H33N5O — CID 5108563
3-methyl-2-(3-methylbutyl)-1-(3-morpholin-4-ylpropylamino)pyrido[1,2-a]benzimidazole-4-carbonitrile (PubChem CID 5108563) has the molecular formula C25H33N5O and a molecular weight of 419.57 g/mol. Its IUPAC name is 3-methyl-2-(3-methylbutyl)-1-(3-morpholin-4-ylpropylamino)pyrido[1,2-a]benzimidazole-4-carbonitrile.
| Compound Name | 3-methyl-2-(3-methylbutyl)-1-(3-morpholin-4-ylpropylamino)pyrido[1,2-a]benzimidazole-4-carbonitrile |
|---|---|
| PubChem CID | 5108563 |
| Molecular Formula | C25H33N5O |
| Molecular Weight | 419.57 g/mol |
| Exact Mass | 419.27 |
| IUPAC Name | 3-methyl-2-(3-methylbutyl)-1-(3-morpholin-4-ylpropylamino)pyrido[1,2-a]benzimidazole-4-carbonitrile |
| SMILES | Cc1c(CCC(C)C)c(NCCCN2CCOCC2)n2c(nc3ccccc32)c1C#N |
| InChI | InChI=1S/C25H33N5O/c1-18(2)9-10-20-19(3)21(17-26)25-28-22-7-4-5-8-23(22)30(25)24(20)27-11-6-12-29-13-15-31-16-14-29/h4-5,7-8,18,27H,6,9-16H2,1-3H3 |
| InChIKey | URILDKZRWDEKEE-UHFFFAOYSA-N |
| XLogP | 4.39 |
| TPSA | 65.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.57 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|