C19H18N2O4 — CID 51086366
N-benzyl-2-cyano-3-(3,5-dimethoxyphenyl)-3-oxopropanamide (PubChem CID 51086366) has the molecular formula C19H18N2O4 and a molecular weight of 338.36 g/mol. Its IUPAC name is N-benzyl-2-cyano-3-(3,5-dimethoxyphenyl)-3-oxopropanamide.
| Compound Name | N-benzyl-2-cyano-3-(3,5-dimethoxyphenyl)-3-oxopropanamide |
|---|---|
| PubChem CID | 51086366 |
| Molecular Formula | C19H18N2O4 |
| Molecular Weight | 338.36 g/mol |
| Exact Mass | 338.13 |
| IUPAC Name | N-benzyl-2-cyano-3-(3,5-dimethoxyphenyl)-3-oxopropanamide |
| SMILES | COc1cc(OC)cc(C(=O)C(C#N)C(=O)NCc2ccccc2)c1 |
| InChI | InChI=1S/C19H18N2O4/c1-24-15-8-14(9-16(10-15)25-2)18(22)17(11-20)19(23)21-12-13-6-4-3-5-7-13/h3-10,17H,12H2,1-2H3,(H,21,23) |
| InChIKey | MGPHHBVOLSDIKV-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 88.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.36 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|