C18H21N3OS — CID 51089112
(E)-N-[3-(3,4-dihydro-1H-isoquinolin-2-yl)propyl]-3-(1,3-thiazol-2-yl)prop-2-enamide (PubChem CID 51089112) has the molecular formula C18H21N3OS and a molecular weight of 327.45 g/mol. Its IUPAC name is (E)-N-[3-(3,4-dihydro-1H-isoquinolin-2-yl)propyl]-3-(1,3-thiazol-2-yl)prop-2-enamide.
| Compound Name | (E)-N-[3-(3,4-dihydro-1H-isoquinolin-2-yl)propyl]-3-(1,3-thiazol-2-yl)prop-2-enamide |
|---|---|
| PubChem CID | 51089112 |
| Molecular Formula | C18H21N3OS |
| Molecular Weight | 327.45 g/mol |
| Exact Mass | 327.14 |
| IUPAC Name | (E)-N-[3-(3,4-dihydro-1H-isoquinolin-2-yl)propyl]-3-(1,3-thiazol-2-yl)prop-2-enamide |
| SMILES | O=C(/C=C/c1nccs1)NCCCN1CCc2ccccc2C1 |
| InChI | InChI=1S/C18H21N3OS/c22-17(6-7-18-20-10-13-23-18)19-9-3-11-21-12-8-15-4-1-2-5-16(15)14-21/h1-2,4-7,10,13H,3,8-9,11-12,14H2,(H,19,22)/b7-6+ |
| InChIKey | WQDFMBYIOOGUMP-VOTSOKGWSA-N |
| XLogP | 2.72 |
| TPSA | 45.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.45 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|