C14H11F2N3OS2 — CID 51092641
2-(cyanomethylsulfanyl)-N-[5-[(2,4-difluorophenyl)methyl]-1,3-thiazol-2-yl]acetamide (PubChem CID 51092641) has the molecular formula C14H11F2N3OS2 and a molecular weight of 339.39 g/mol. Its IUPAC name is 2-(cyanomethylsulfanyl)-N-[5-[(2,4-difluorophenyl)methyl]-1,3-thiazol-2-yl]acetamide.
| Compound Name | 2-(cyanomethylsulfanyl)-N-[5-[(2,4-difluorophenyl)methyl]-1,3-thiazol-2-yl]acetamide |
|---|---|
| PubChem CID | 51092641 |
| Molecular Formula | C14H11F2N3OS2 |
| Molecular Weight | 339.39 g/mol |
| Exact Mass | 339.03 |
| IUPAC Name | 2-(cyanomethylsulfanyl)-N-[5-[(2,4-difluorophenyl)methyl]-1,3-thiazol-2-yl]acetamide |
| SMILES | N#CCSCC(=O)Nc1ncc(Cc2ccc(F)cc2F)s1 |
| InChI | InChI=1S/C14H11F2N3OS2/c15-10-2-1-9(12(16)6-10)5-11-7-18-14(22-11)19-13(20)8-21-4-3-17/h1-2,6-7H,4-5,8H2,(H,18,19,20) |
| InChIKey | VWMONFLRHLXYNX-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 65.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.39 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|