C20H13F2N3O2S — CID 60578744
(E)-3-(1,3-benzoxazol-2-yl)-N-[5-[(2,4-difluorophenyl)methyl]-1,3-thiazol-2-yl]prop-2-enamide (PubChem CID 60578744) has the molecular formula C20H13F2N3O2S and a molecular weight of 397.41 g/mol. Its IUPAC name is (E)-3-(1,3-benzoxazol-2-yl)-N-[5-[(2,4-difluorophenyl)methyl]-1,3-thiazol-2-yl]prop-2-enamide.
| Compound Name | (E)-3-(1,3-benzoxazol-2-yl)-N-[5-[(2,4-difluorophenyl)methyl]-1,3-thiazol-2-yl]prop-2-enamide |
|---|---|
| PubChem CID | 60578744 |
| Molecular Formula | C20H13F2N3O2S |
| Molecular Weight | 397.41 g/mol |
| Exact Mass | 397.07 |
| IUPAC Name | (E)-3-(1,3-benzoxazol-2-yl)-N-[5-[(2,4-difluorophenyl)methyl]-1,3-thiazol-2-yl]prop-2-enamide |
| SMILES | O=C(/C=C/c1nc2ccccc2o1)Nc1ncc(Cc2ccc(F)cc2F)s1 |
| InChI | InChI=1S/C20H13F2N3O2S/c21-13-6-5-12(15(22)10-13)9-14-11-23-20(28-14)25-18(26)7-8-19-24-16-3-1-2-4-17(16)27-19/h1-8,10-11H,9H2,(H,23,25,26)/b8-7+ |
| InChIKey | KGLWQMFORFGQBA-BQYQJAHWSA-N |
| XLogP | 4.81 |
| TPSA | 68.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.41 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|