C18H14F2N2O2 — CID 38224728
(E)-3-(1,3-benzoxazol-2-yl)-N-[(2,4-difluorophenyl)methyl]-N-methylprop-2-enamide (PubChem CID 38224728) has the molecular formula C18H14F2N2O2 and a molecular weight of 328.32 g/mol. Its IUPAC name is (E)-3-(1,3-benzoxazol-2-yl)-N-[(2,4-difluorophenyl)methyl]-N-methylprop-2-enamide.
| Compound Name | (E)-3-(1,3-benzoxazol-2-yl)-N-[(2,4-difluorophenyl)methyl]-N-methylprop-2-enamide |
|---|---|
| PubChem CID | 38224728 |
| Molecular Formula | C18H14F2N2O2 |
| Molecular Weight | 328.32 g/mol |
| Exact Mass | 328.10 |
| IUPAC Name | (E)-3-(1,3-benzoxazol-2-yl)-N-[(2,4-difluorophenyl)methyl]-N-methylprop-2-enamide |
| SMILES | CN(Cc1ccc(F)cc1F)C(=O)/C=C/c1nc2ccccc2o1 |
| InChI | InChI=1S/C18H14F2N2O2/c1-22(11-12-6-7-13(19)10-14(12)20)18(23)9-8-17-21-15-4-2-3-5-16(15)24-17/h2-10H,11H2,1H3/b9-8+ |
| InChIKey | BFUWHNVNGKHIDD-CMDGGOBGSA-N |
| XLogP | 3.78 |
| TPSA | 46.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.32 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|