C20H20N2O3 — CID 95778124
(E)-3-(1,3-benzoxazol-2-yl)-N-benzyl-N-[(2R)-2-hydroxypropyl]prop-2-enamide (PubChem CID 95778124) has the molecular formula C20H20N2O3 and a molecular weight of 336.39 g/mol. Its IUPAC name is (E)-3-(1,3-benzoxazol-2-yl)-N-benzyl-N-[(2R)-2-hydroxypropyl]prop-2-enamide.
| Compound Name | (E)-3-(1,3-benzoxazol-2-yl)-N-benzyl-N-[(2R)-2-hydroxypropyl]prop-2-enamide |
|---|---|
| PubChem CID | 95778124 |
| Molecular Formula | C20H20N2O3 |
| Molecular Weight | 336.39 g/mol |
| Exact Mass | 336.15 |
| IUPAC Name | (E)-3-(1,3-benzoxazol-2-yl)-N-benzyl-N-[(2R)-2-hydroxypropyl]prop-2-enamide |
| SMILES | C[C@@H](O)CN(Cc1ccccc1)C(=O)/C=C/c1nc2ccccc2o1 |
| InChI | InChI=1S/C20H20N2O3/c1-15(23)13-22(14-16-7-3-2-4-8-16)20(24)12-11-19-21-17-9-5-6-10-18(17)25-19/h2-12,15,23H,13-14H2,1H3/b12-11+/t15-/m1/s1 |
| InChIKey | YTNCRXBYEPLHHX-AYJWMTRPSA-N |
| XLogP | 3.25 |
| TPSA | 66.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.39 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|