C24H22N2O2S — CID 17437615
(E)-3-(1,3-benzoxazol-2-yl)-N-benzyl-N-(1-thiophen-2-ylpropan-2-yl)prop-2-enamide (PubChem CID 17437615) has the molecular formula C24H22N2O2S and a molecular weight of 402.52 g/mol. Its IUPAC name is (E)-3-(1,3-benzoxazol-2-yl)-N-benzyl-N-(1-thiophen-2-ylpropan-2-yl)prop-2-enamide.
| Compound Name | (E)-3-(1,3-benzoxazol-2-yl)-N-benzyl-N-(1-thiophen-2-ylpropan-2-yl)prop-2-enamide |
|---|---|
| PubChem CID | 17437615 |
| Molecular Formula | C24H22N2O2S |
| Molecular Weight | 402.52 g/mol |
| Exact Mass | 402.14 |
| IUPAC Name | (E)-3-(1,3-benzoxazol-2-yl)-N-benzyl-N-(1-thiophen-2-ylpropan-2-yl)prop-2-enamide |
| SMILES | CC(Cc1cccs1)N(Cc1ccccc1)C(=O)/C=C/c1nc2ccccc2o1 |
| InChI | InChI=1S/C24H22N2O2S/c1-18(16-20-10-7-15-29-20)26(17-19-8-3-2-4-9-19)24(27)14-13-23-25-21-11-5-6-12-22(21)28-23/h2-15,18H,16-17H2,1H3/b14-13+ |
| InChIKey | SYWUPTZEXHEPPS-BUHFOSPRSA-N |
| XLogP | 5.56 |
| TPSA | 46.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.52 |
| LogP ≤ 5 | 5.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|