C21H21IN2O2 — CID 88836135
N-[4-(1,3-benzoxazol-2-yl)buta-1,3-dienyl]-N-phenylacetamide;iodoethane (PubChem CID 88836135) has the molecular formula C21H21IN2O2 and a molecular weight of 460.32 g/mol. Its IUPAC name is N-[4-(1,3-benzoxazol-2-yl)buta-1,3-dienyl]-N-phenylacetamide;iodoethane.
| Compound Name | N-[4-(1,3-benzoxazol-2-yl)buta-1,3-dienyl]-N-phenylacetamide;iodoethane |
|---|---|
| PubChem CID | 88836135 |
| Molecular Formula | C21H21IN2O2 |
| Molecular Weight | 460.32 g/mol |
| Exact Mass | 460.06 |
| IUPAC Name | N-[4-(1,3-benzoxazol-2-yl)buta-1,3-dienyl]-N-phenylacetamide;iodoethane |
| SMILES | CC(=O)N(C=CC=Cc1nc2ccccc2o1)c1ccccc1.CCI |
| InChI | InChI=1S/C19H16N2O2.C2H5I/c1-15(22)21(16-9-3-2-4-10-16)14-8-7-13-19-20-17-11-5-6-12-18(17)23-19;1-2-3/h2-14H,1H3;2H2,1H3 |
| InChIKey | VDNXWVJSAVAPOE-UHFFFAOYSA-N |
| XLogP | 5.85 |
| TPSA | 46.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.32 |
| LogP ≤ 5 | 5.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|