C18H23N3O3 — CID 35362287
(E)-3-(1,3-benzoxazol-2-yl)-N-[2-(tert-butylamino)-2-oxoethyl]-N-ethylprop-2-enamide (PubChem CID 35362287) has the molecular formula C18H23N3O3 and a molecular weight of 329.40 g/mol. Its IUPAC name is (E)-3-(1,3-benzoxazol-2-yl)-N-[2-(tert-butylamino)-2-oxoethyl]-N-ethylprop-2-enamide.
| Compound Name | (E)-3-(1,3-benzoxazol-2-yl)-N-[2-(tert-butylamino)-2-oxoethyl]-N-ethylprop-2-enamide |
|---|---|
| PubChem CID | 35362287 |
| Molecular Formula | C18H23N3O3 |
| Molecular Weight | 329.40 g/mol |
| Exact Mass | 329.17 |
| IUPAC Name | (E)-3-(1,3-benzoxazol-2-yl)-N-[2-(tert-butylamino)-2-oxoethyl]-N-ethylprop-2-enamide |
| SMILES | CCN(CC(=O)NC(C)(C)C)C(=O)/C=C/c1nc2ccccc2o1 |
| InChI | InChI=1S/C18H23N3O3/c1-5-21(12-15(22)20-18(2,3)4)17(23)11-10-16-19-13-8-6-7-9-14(13)24-16/h6-11H,5,12H2,1-4H3,(H,20,22)/b11-10+ |
| InChIKey | HASPOZQYIQLRJN-ZHACJKMWSA-N |
| XLogP | 2.60 |
| TPSA | 75.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.40 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|