C16H13BrN2O2S — CID 32544769
(E)-3-(1,3-benzoxazol-2-yl)-N-[(5-bromothiophen-2-yl)methyl]-N-methylprop-2-enamide (PubChem CID 32544769) has the molecular formula C16H13BrN2O2S and a molecular weight of 377.26 g/mol. Its IUPAC name is (E)-3-(1,3-benzoxazol-2-yl)-N-[(5-bromothiophen-2-yl)methyl]-N-methylprop-2-enamide.
| Compound Name | (E)-3-(1,3-benzoxazol-2-yl)-N-[(5-bromothiophen-2-yl)methyl]-N-methylprop-2-enamide |
|---|---|
| PubChem CID | 32544769 |
| Molecular Formula | C16H13BrN2O2S |
| Molecular Weight | 377.26 g/mol |
| Exact Mass | 375.99 |
| IUPAC Name | (E)-3-(1,3-benzoxazol-2-yl)-N-[(5-bromothiophen-2-yl)methyl]-N-methylprop-2-enamide |
| SMILES | CN(Cc1ccc(Br)s1)C(=O)/C=C/c1nc2ccccc2o1 |
| InChI | InChI=1S/C16H13BrN2O2S/c1-19(10-11-6-7-14(17)22-11)16(20)9-8-15-18-12-4-2-3-5-13(12)21-15/h2-9H,10H2,1H3/b9-8+ |
| InChIKey | YIZVLDPACRJUQK-CMDGGOBGSA-N |
| XLogP | 4.32 |
| TPSA | 46.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.26 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|