C19H13F2N3O3S — CID 60578519
(E)-N-[5-[(2,4-difluorophenyl)methyl]-1,3-thiazol-2-yl]-3-(3-nitrophenyl)prop-2-enamide (PubChem CID 60578519) has the molecular formula C19H13F2N3O3S and a molecular weight of 401.39 g/mol. Its IUPAC name is (E)-N-[5-[(2,4-difluorophenyl)methyl]-1,3-thiazol-2-yl]-3-(3-nitrophenyl)prop-2-enamide.
| Compound Name | (E)-N-[5-[(2,4-difluorophenyl)methyl]-1,3-thiazol-2-yl]-3-(3-nitrophenyl)prop-2-enamide |
|---|---|
| PubChem CID | 60578519 |
| Molecular Formula | C19H13F2N3O3S |
| Molecular Weight | 401.39 g/mol |
| Exact Mass | 401.06 |
| IUPAC Name | (E)-N-[5-[(2,4-difluorophenyl)methyl]-1,3-thiazol-2-yl]-3-(3-nitrophenyl)prop-2-enamide |
| SMILES | O=C(/C=C/c1cccc([N+](=O)[O-])c1)Nc1ncc(Cc2ccc(F)cc2F)s1 |
| InChI | InChI=1S/C19H13F2N3O3S/c20-14-6-5-13(17(21)10-14)9-16-11-22-19(28-16)23-18(25)7-4-12-2-1-3-15(8-12)24(26)27/h1-8,10-11H,9H2,(H,22,23,25)/b7-4+ |
| InChIKey | HUZOAGQBSPXIFT-QPJJXVBHSA-N |
| XLogP | 4.57 |
| TPSA | 85.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.39 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|