C14H9ClF2N2O2S — CID 51092863
3-chloro-4-cyano-N-(2,6-difluorophenyl)-N-methylbenzenesulfonamide (PubChem CID 51092863) has the molecular formula C14H9ClF2N2O2S and a molecular weight of 342.75 g/mol. Its IUPAC name is 3-chloro-4-cyano-N-(2,6-difluorophenyl)-N-methylbenzenesulfonamide.
| Compound Name | 3-chloro-4-cyano-N-(2,6-difluorophenyl)-N-methylbenzenesulfonamide |
|---|---|
| PubChem CID | 51092863 |
| Molecular Formula | C14H9ClF2N2O2S |
| Molecular Weight | 342.75 g/mol |
| Exact Mass | 342.00 |
| IUPAC Name | 3-chloro-4-cyano-N-(2,6-difluorophenyl)-N-methylbenzenesulfonamide |
| SMILES | CN(c1c(F)cccc1F)S(=O)(=O)c1ccc(C#N)c(Cl)c1 |
| InChI | InChI=1S/C14H9ClF2N2O2S/c1-19(14-12(16)3-2-4-13(14)17)22(20,21)10-6-5-9(8-18)11(15)7-10/h2-7H,1H3 |
| InChIKey | FAMHXVJZVANCLP-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 61.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.75 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |