C14H11NO3S — CID 51093336
1,3-thiazol-2-ylmethyl 2H-chromene-3-carboxylate (PubChem CID 51093336) has the molecular formula C14H11NO3S and a molecular weight of 273.31 g/mol. Its IUPAC name is 1,3-thiazol-2-ylmethyl 2H-chromene-3-carboxylate.
| Compound Name | 1,3-thiazol-2-ylmethyl 2H-chromene-3-carboxylate |
|---|---|
| PubChem CID | 51093336 |
| Molecular Formula | C14H11NO3S |
| Molecular Weight | 273.31 g/mol |
| Exact Mass | 273.05 |
| IUPAC Name | 1,3-thiazol-2-ylmethyl 2H-chromene-3-carboxylate |
| SMILES | O=C(OCc1nccs1)C1=Cc2ccccc2OC1 |
| InChI | InChI=1S/C14H11NO3S/c16-14(18-9-13-15-5-6-19-13)11-7-10-3-1-2-4-12(10)17-8-11/h1-7H,8-9H2 |
| InChIKey | NQESBPQQRGBYQD-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 48.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.31 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |