C16H18N2OS2 — CID 51095235
N-cyclopropyl-2-(pyridin-2-ylmethylsulfanyl)-N-(thiophen-3-ylmethyl)acetamide (PubChem CID 51095235) has the molecular formula C16H18N2OS2 and a molecular weight of 318.47 g/mol. Its IUPAC name is N-cyclopropyl-2-(pyridin-2-ylmethylsulfanyl)-N-(thiophen-3-ylmethyl)acetamide.
| Compound Name | N-cyclopropyl-2-(pyridin-2-ylmethylsulfanyl)-N-(thiophen-3-ylmethyl)acetamide |
|---|---|
| PubChem CID | 51095235 |
| Molecular Formula | C16H18N2OS2 |
| Molecular Weight | 318.47 g/mol |
| Exact Mass | 318.09 |
| IUPAC Name | N-cyclopropyl-2-(pyridin-2-ylmethylsulfanyl)-N-(thiophen-3-ylmethyl)acetamide |
| SMILES | O=C(CSCc1ccccn1)N(Cc1ccsc1)C1CC1 |
| InChI | InChI=1S/C16H18N2OS2/c19-16(12-21-11-14-3-1-2-7-17-14)18(15-4-5-15)9-13-6-8-20-10-13/h1-3,6-8,10,15H,4-5,9,11-12H2 |
| InChIKey | SCDOBJKZUUFTAF-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 33.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.47 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |