C17H23N3O2S — CID 51095691
(E)-N-[2-(diethylamino)-2-(furan-2-yl)ethyl]-3-(2-methyl-1,3-thiazol-4-yl)prop-2-enamide (PubChem CID 51095691) has the molecular formula C17H23N3O2S and a molecular weight of 333.46 g/mol. Its IUPAC name is (E)-N-[2-(diethylamino)-2-(furan-2-yl)ethyl]-3-(2-methyl-1,3-thiazol-4-yl)prop-2-enamide.
| Compound Name | (E)-N-[2-(diethylamino)-2-(furan-2-yl)ethyl]-3-(2-methyl-1,3-thiazol-4-yl)prop-2-enamide |
|---|---|
| PubChem CID | 51095691 |
| Molecular Formula | C17H23N3O2S |
| Molecular Weight | 333.46 g/mol |
| Exact Mass | 333.15 |
| IUPAC Name | (E)-N-[2-(diethylamino)-2-(furan-2-yl)ethyl]-3-(2-methyl-1,3-thiazol-4-yl)prop-2-enamide |
| SMILES | CCN(CC)C(CNC(=O)/C=C/c1csc(C)n1)c1ccco1 |
| InChI | InChI=1S/C17H23N3O2S/c1-4-20(5-2)15(16-7-6-10-22-16)11-18-17(21)9-8-14-12-23-13(3)19-14/h6-10,12,15H,4-5,11H2,1-3H3,(H,18,21)/b9-8+ |
| InChIKey | CZHSXLCUNCTPRJ-CMDGGOBGSA-N |
| XLogP | 3.26 |
| TPSA | 58.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.46 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|